C12H24O10 — CID 157202007
(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal;(3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal (PubChem CID 157202007) has the molecular formula C12H24O10 and a molecular weight of 328.31 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal;(3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal;(3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 157202007 |
| Molecular Formula | C12H24O10 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal;(3R,4S,5R)-3,4,5,6-tetrahydroxyhexanal |
| SMILES | C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O.O=CC[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C6H12O5/c1-3(8)5(10)6(11)4(9)2-7;7-2-1-4(9)6(11)5(10)3-8/h2-6,8-11H,1H3;2,4-6,8-11H,1,3H2/t3-,4+,5+,6-;4-,5-,6+/m11/s1 |
| InChIKey | AQXDLGIHANHBKM-JKORXPFKSA-N |
| XLogP | -4.70 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|