C17H34O16 — CID 159034378
(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2R,3S,4S)-2,3,4,5-tetrahydroxypentanal (PubChem CID 159034378) has the molecular formula C17H34O16 and a molecular weight of 494.44 g/mol. Its IUPAC name is (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2R,3S,4S)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2R,3S,4S)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 159034378 |
| Molecular Formula | C17H34O16 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2R,3S,4S)-2,3,4,5-tetrahydroxypentanal |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O.O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O6.C6H12O5.C5H10O5/c7-1-3(9)5(11)6(12)4(10)2-8;1-3(8)5(10)6(11)4(9)2-7;6-1-3(8)5(10)4(9)2-7/h3,5-9,11-12H,1-2H2;2-6,8-11H,1H3;1,3-5,7-10H,2H2/t3-,5-,6-;3-,4-,5-,6-;3-,4-,5+/m100/s1 |
| InChIKey | JVGVUGFMNUQCIA-RURWORIMSA-N |
| XLogP | -8.47 |
| TPSA | 314.20 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | -8.47 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|