C10H20O10 — CID 87502838
(2S,3S,4R)-2,3,4,5-tetrahydroxypentanal;(3S,4R)-1,3,4,5-tetrahydroxypentan-2-one (PubChem CID 87502838) has the molecular formula C10H20O10 and a molecular weight of 300.26 g/mol. Its IUPAC name is (2S,3S,4R)-2,3,4,5-tetrahydroxypentanal;(3S,4R)-1,3,4,5-tetrahydroxypentan-2-one.
| Compound Name | (2S,3S,4R)-2,3,4,5-tetrahydroxypentanal;(3S,4R)-1,3,4,5-tetrahydroxypentan-2-one |
|---|---|
| PubChem CID | 87502838 |
| Molecular Formula | C10H20O10 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2S,3S,4R)-2,3,4,5-tetrahydroxypentanal;(3S,4R)-1,3,4,5-tetrahydroxypentan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)CO.O=C[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C5H10O5/c2*6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2;1,3-5,7-10H,2H2/t3-,5+;3-,4-,5-/m11/s1 |
| InChIKey | IQVRHVQUIHYHCW-KXGWXHTHSA-N |
| XLogP | -5.48 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|