C18H36O18 — CID 174367583
bis(2,3,4,5,6-pentahydroxyhexanal);1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174367583) has the molecular formula C18H36O18 and a molecular weight of 540.47 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentahydroxyhexanal);1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | bis(2,3,4,5,6-pentahydroxyhexanal);1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174367583 |
| Molecular Formula | C18H36O18 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | bis(2,3,4,5,6-pentahydroxyhexanal);1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)C(O)C(O)C(O)CO.O=CC(O)C(O)C(O)C(O)CO.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/3C6H12O6/c3*7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2;2*1,3-6,8-12H,2H2 |
| InChIKey | ZHAURGPSJHBQEI-UHFFFAOYSA-N |
| XLogP | -10.13 |
| TPSA | 354.66 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | -10.13 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|