C6H12N3O5- — CID 89407664
(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal azide (PubChem CID 89407664) has the molecular formula C6H12N3O5- and a molecular weight of 206.18 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal azide.
| Compound Name | (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal azide |
|---|---|
| PubChem CID | 89407664 |
| Molecular Formula | C6H12N3O5- |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal azide |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C6H12O5.N3/c1-3(8)5(10)6(11)4(9)2-7;1-3-2/h2-6,8-11H,1H3;/q;-1/t3-,4+,5+,6-;/m0./s1 |
| InChIKey | OEJBPIDBOWOFRC-NQZVPSPJSA-N |
| XLogP | -1.49 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|