C10H16O6 — CID 174834063
furan;2,3,4,5-tetrahydroxyhexanal (PubChem CID 174834063) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is furan;2,3,4,5-tetrahydroxyhexanal.
| Compound Name | furan;2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174834063 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | furan;2,3,4,5-tetrahydroxyhexanal |
| SMILES | CC(O)C(O)C(O)C(O)C=O.c1ccoc1 |
| InChI | InChI=1S/C6H12O5.C4H4O/c1-3(8)5(10)6(11)4(9)2-7;1-2-4-5-3-1/h2-6,8-11H,1H3;1-4H |
| InChIKey | JRYKYEPPJYTTOG-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|