C9H17NO6 — CID 87645178
prop-2-enamide;(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal (PubChem CID 87645178) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is prop-2-enamide;(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal.
| Compound Name | prop-2-enamide;(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 87645178 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | prop-2-enamide;(2R,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal |
| SMILES | C=CC(N)=O.C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C6H12O5.C3H5NO/c1-3(8)5(10)6(11)4(9)2-7;1-2-3(4)5/h2-6,8-11H,1H3;2H,1H2,(H2,4,5)/t3-,4+,5+,6-;/m1./s1 |
| InChIKey | VHIGYDOYLJPNNK-OLALXQGDSA-N |
| XLogP | -2.69 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|