C8H18O5 — CID 174774074
ethane;2,3,4,5-tetrahydroxyhexanal (PubChem CID 174774074) has the molecular formula C8H18O5 and a molecular weight of 194.23 g/mol. Its IUPAC name is ethane;2,3,4,5-tetrahydroxyhexanal.
| Compound Name | ethane;2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174774074 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | ethane;2,3,4,5-tetrahydroxyhexanal |
| SMILES | CC.CC(O)C(O)C(O)C(O)C=O |
| InChI | InChI=1S/C6H12O5.C2H6/c1-3(8)5(10)6(11)4(9)2-7;1-2/h2-6,8-11H,1H3;1-2H3 |
| InChIKey | MBPTXOHLGNNWEH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|