C6H16N2O8 — CID 174863024
azane;nitric acid;2,3,4,5-tetrahydroxyhexanal (PubChem CID 174863024) has the molecular formula C6H16N2O8 and a molecular weight of 244.20 g/mol. Its IUPAC name is azane;nitric acid;2,3,4,5-tetrahydroxyhexanal.
| Compound Name | azane;nitric acid;2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174863024 |
| Molecular Formula | C6H16N2O8 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | azane;nitric acid;2,3,4,5-tetrahydroxyhexanal |
| SMILES | CC(O)C(O)C(O)C(O)C=O.N.O=[N+]([O-])O |
| InChI | InChI=1S/C6H12O5.HNO3.H3N/c1-3(8)5(10)6(11)4(9)2-7;2-1(3)4;/h2-6,8-11H,1H3;(H,2,3,4);1H3 |
| InChIKey | MFDASMNSTOHGAL-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 196.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|