C6H11NO8 — CID 174867375
2,3,4,5,6-pentahydroxy-6-nitrohexanal (PubChem CID 174867375) has the molecular formula C6H11NO8 and a molecular weight of 225.15 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-6-nitrohexanal.
| Compound Name | 2,3,4,5,6-pentahydroxy-6-nitrohexanal |
|---|---|
| PubChem CID | 174867375 |
| Molecular Formula | C6H11NO8 |
| Molecular Weight | 225.15 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-6-nitrohexanal |
| SMILES | O=CC(O)C(O)C(O)C(O)C(O)[N+](=O)[O-] |
| InChI | InChI=1S/C6H11NO8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h1-6,9-13H |
| InChIKey | QFRMEYINJNZIHX-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.15 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|