C4H7NO5 — CID 72707826
(2S)-2,3-dihydroxy-4-nitrobutanal (PubChem CID 72707826) has the molecular formula C4H7NO5 and a molecular weight of 149.10 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-4-nitrobutanal.
| Compound Name | (2S)-2,3-dihydroxy-4-nitrobutanal |
|---|---|
| PubChem CID | 72707826 |
| Molecular Formula | C4H7NO5 |
| Molecular Weight | 149.10 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | (2S)-2,3-dihydroxy-4-nitrobutanal |
| SMILES | O=C[C@@H](O)C(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C4H7NO5/c6-2-4(8)3(7)1-5(9)10/h2-4,7-8H,1H2/t3?,4-/m1/s1 |
| InChIKey | PBGSJEXZBVDWKP-SRBOSORUSA-N |
| XLogP | -1.82 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.10 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|