About (2S)-2,3-dihydroxy-4-nitrobutanal
(2S)-2,3-dihydroxy-4-nitrobutanal (PubChem CID 72707826) has the molecular formula C4H7NO5
and a molecular weight of 149.10 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-4-nitrobutanal.
Molecular Properties
| Compound Name | (2S)-2,3-dihydroxy-4-nitrobutanal |
| PubChem CID | 72707826 |
| Molecular Formula | C4H7NO5 |
| Molecular Weight | 149.10 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | (2S)-2,3-dihydroxy-4-nitrobutanal |
| SMILES | O=C[C@@H](O)C(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C4H7NO5/c6-2-4(8)3(7)1-5(9)10/h2-4,7-8H,1H2/t3?,4-/m1/s1 |
| InChIKey | PBGSJEXZBVDWKP-SRBOSORUSA-N |
| XLogP | -1.82 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.10 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,3-dihydroxy-4-nitrobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dihydroxy-4-nitrobutanal?
The IUPAC name of (2S)-2,3-dihydroxy-4-nitrobutanal (CID 72707826) is (2S)-2,3-dihydroxy-4-nitrobutanal.
What is the SMILES notation for (2S)-2,3-dihydroxy-4-nitrobutanal?
The canonical SMILES for (2S)-2,3-dihydroxy-4-nitrobutanal is O=C[C@@H](O)C(O)C[N+](=O)[O-].
What is the InChIKey of (2S)-2,3-dihydroxy-4-nitrobutanal?
The InChIKey is PBGSJEXZBVDWKP-SRBOSORUSA-N. The full InChI is InChI=1S/C4H7NO5/c6-2-4(8)3(7)1-5(9)10/h2-4,7-8H,1H2/t3?,4-/m1/s1.
What are the key properties of (2S)-2,3-dihydroxy-4-nitrobutanal?
(2S)-2,3-dihydroxy-4-nitrobutanal has a molecular weight of 149.10 g/mol, XLogP of -1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dihydroxy-4-nitrobutanal is sourced from PubChem (CID 72707826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).