C4H18O9 — CID 140967794
(2S,3R)-2,3,4-trihydroxybutanal;pentahydrate (PubChem CID 140967794) has the molecular formula C4H18O9 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2S,3R)-2,3,4-trihydroxybutanal;pentahydrate.
| Compound Name | (2S,3R)-2,3,4-trihydroxybutanal;pentahydrate |
|---|---|
| PubChem CID | 140967794 |
| Molecular Formula | C4H18O9 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (2S,3R)-2,3,4-trihydroxybutanal;pentahydrate |
| SMILES | O.O.O.O.O.O=C[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O4.5H2O/c5-1-3(7)4(8)2-6;;;;;/h1,3-4,6-8H,2H2;5*1H2/t3-,4-;;;;;/m1...../s1 |
| InChIKey | XZFCIJSABDAERK-DFPUYHHLSA-N |
| XLogP | -6.22 |
| TPSA | 235.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|