C4H8O4 — CID 131883807
(2S,3R)-2,3,4-trihydroxy(113C)butanal (PubChem CID 131883807) has the molecular formula C4H8O4 and a molecular weight of 121.10 g/mol. Its IUPAC name is (2S,3R)-2,3,4-trihydroxy(113C)butanal.
| Compound Name | (2S,3R)-2,3,4-trihydroxy(113C)butanal |
|---|---|
| PubChem CID | 131883807 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 121.10 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | (2S,3R)-2,3,4-trihydroxy(113C)butanal |
| SMILES | O=[13CH][C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h1,3-4,6-8H,2H2/t3-,4-/m1/s1/i1+1 |
| InChIKey | YTBSYETUWUMLBZ-CQSAUBDGSA-N |
| XLogP | -2.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.10 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|