C7H12N2O4 — CID 90327000
N-[(2S,3R)-3-methyl-1-nitro-4-oxobutan-2-yl]acetamide (PubChem CID 90327000) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is N-[(2S,3R)-3-methyl-1-nitro-4-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-3-methyl-1-nitro-4-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 90327000 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | N-[(2S,3R)-3-methyl-1-nitro-4-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C[N+](=O)[O-])[C@@H](C)C=O |
| InChI | InChI=1S/C7H12N2O4/c1-5(4-10)7(3-9(12)13)8-6(2)11/h4-5,7H,3H2,1-2H3,(H,8,11)/t5-,7+/m0/s1 |
| InChIKey | VAWUCSQPFOYQMM-CAHLUQPWSA-N |
| XLogP | -0.40 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|