C8H15NO5 — CID 71406934
(2R,3R)-4,4-dimethoxy-2-methyl-3-(nitromethyl)butanal (PubChem CID 71406934) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (2R,3R)-4,4-dimethoxy-2-methyl-3-(nitromethyl)butanal.
| Compound Name | (2R,3R)-4,4-dimethoxy-2-methyl-3-(nitromethyl)butanal |
|---|---|
| PubChem CID | 71406934 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (2R,3R)-4,4-dimethoxy-2-methyl-3-(nitromethyl)butanal |
| SMILES | COC(OC)[C@@H](C[N+](=O)[O-])[C@@H](C)C=O |
| InChI | InChI=1S/C8H15NO5/c1-6(5-10)7(4-9(11)12)8(13-2)14-3/h5-8H,4H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | ODTYCYJCXRQAKT-BQBZGAKWSA-N |
| XLogP | 0.33 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|