C11H12NO3Y- — CID 134950576
(2R,3S)-2-methyl-4-nitro-3-phenylbutanal;yttrium (PubChem CID 134950576) has the molecular formula C11H12NO3Y- and a molecular weight of 295.13 g/mol. Its IUPAC name is (2R,3S)-2-methyl-4-nitro-3-phenylbutanal;yttrium.
| Compound Name | (2R,3S)-2-methyl-4-nitro-3-phenylbutanal;yttrium |
|---|---|
| PubChem CID | 134950576 |
| Molecular Formula | C11H12NO3Y- |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | (2R,3S)-2-methyl-4-nitro-3-phenylbutanal;yttrium |
| SMILES | C[C@@H](C=O)[C@H](C[N+](=O)[O-])c1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C11H12NO3.Y/c1-9(8-13)11(7-12(14)15)10-5-3-2-4-6-10;/h3-6,8-9,11H,7H2,1H3;/q-1;/t9-,11-;/m0./s1 |
| InChIKey | VASOSFLGOUPDJS-ROLPUNSJSA-N |
| XLogP | 1.68 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|