C11H14N2O4 — CID 102516673
1-(1,3-dinitrobutan-2-yl)-4-methylbenzene (PubChem CID 102516673) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-(1,3-dinitrobutan-2-yl)-4-methylbenzene.
| Compound Name | 1-(1,3-dinitrobutan-2-yl)-4-methylbenzene |
|---|---|
| PubChem CID | 102516673 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-(1,3-dinitrobutan-2-yl)-4-methylbenzene |
| SMILES | Cc1ccc(C(C[N+](=O)[O-])C(C)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H14N2O4/c1-8-3-5-10(6-4-8)11(7-12(14)15)9(2)13(16)17/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | CBQQFBXYGXJQPH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|