C8H10N2O5 — CID 73035350
2-(1,3-dinitrobutan-2-yl)furan (PubChem CID 73035350) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-(1,3-dinitrobutan-2-yl)furan.
| Compound Name | 2-(1,3-dinitrobutan-2-yl)furan |
|---|---|
| PubChem CID | 73035350 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(1,3-dinitrobutan-2-yl)furan |
| SMILES | CC(C(C[N+](=O)[O-])c1ccco1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O5/c1-6(10(13)14)7(5-9(11)12)8-3-2-4-15-8/h2-4,6-7H,5H2,1H3 |
| InChIKey | ZPTGPJUVFJFEFW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|