About 2-(2-nitropropyl)furan
2-(2-nitropropyl)furan (PubChem CID 14929135) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 2-(2-nitropropyl)furan.
Molecular Properties
| Compound Name | 2-(2-nitropropyl)furan |
| PubChem CID | 14929135 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 2-(2-nitropropyl)furan |
| SMILES | CC(Cc1ccco1)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9NO3/c1-6(8(9)10)5-7-3-2-4-11-7/h2-4,6H,5H2,1H3 |
| InChIKey | LWDRHEZLLXUWNE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitropropyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitropropyl)furan?
The IUPAC name of 2-(2-nitropropyl)furan (CID 14929135) is 2-(2-nitropropyl)furan.
What is the SMILES notation for 2-(2-nitropropyl)furan?
The canonical SMILES for 2-(2-nitropropyl)furan is CC(Cc1ccco1)[N+](=O)[O-].
What is the InChIKey of 2-(2-nitropropyl)furan?
The InChIKey is LWDRHEZLLXUWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-6(8(9)10)5-7-3-2-4-11-7/h2-4,6H,5H2,1H3.
What are the key properties of 2-(2-nitropropyl)furan?
2-(2-nitropropyl)furan has a molecular weight of 155.15 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitropropyl)furan is sourced from PubChem (CID 14929135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).