C6H8O3 — CID 156698008
2-(furan-2-yl)ethane-1,1-diol (PubChem CID 156698008) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-(furan-2-yl)ethane-1,1-diol.
| Compound Name | 2-(furan-2-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 156698008 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 2-(furan-2-yl)ethane-1,1-diol |
| SMILES | OC(O)Cc1ccco1 |
| InChI | InChI=1S/C6H8O3/c7-6(8)4-5-2-1-3-9-5/h1-3,6-8H,4H2 |
| InChIKey | WLTDLGBPNCKMBD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|