C11H18O7 — CID 141064125
(2R,3R,4R,5S)-7-(furan-2-yl)heptane-1,2,3,4,5,6-hexol (PubChem CID 141064125) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is (2R,3R,4R,5S)-7-(furan-2-yl)heptane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4R,5S)-7-(furan-2-yl)heptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141064125 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2R,3R,4R,5S)-7-(furan-2-yl)heptane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)Cc1ccco1 |
| InChI | InChI=1S/C11H18O7/c12-5-8(14)10(16)11(17)9(15)7(13)4-6-2-1-3-18-6/h1-3,7-17H,4-5H2/t7?,8-,9+,10-,11-/m1/s1 |
| InChIKey | UEJPZVWWNKISKU-OXKBGPBOSA-N |
| XLogP | -2.38 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |