C13H18O6 — CID 174940429
2-(furan-2-ylmethoxymethyl)furan;propane-1,2,3-triol (PubChem CID 174940429) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(furan-2-ylmethoxymethyl)furan;propane-1,2,3-triol.
| Compound Name | 2-(furan-2-ylmethoxymethyl)furan;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174940429 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(furan-2-ylmethoxymethyl)furan;propane-1,2,3-triol |
| SMILES | OCC(O)CO.c1coc(COCc2ccco2)c1 |
| InChI | InChI=1S/C10H10O3.C3H8O3/c1-3-9(12-5-1)7-11-8-10-4-2-6-13-10;4-1-3(6)2-5/h1-6H,7-8H2;3-6H,1-2H2 |
| InChIKey | WKMJLGSVWARWRG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |