C12H19NO3 — CID 942774
(2S)-1-(furan-2-ylmethoxy)-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 942774) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S)-1-(furan-2-ylmethoxy)-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | (2S)-1-(furan-2-ylmethoxy)-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 942774 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (2S)-1-(furan-2-ylmethoxy)-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | O[C@H](COCc1ccco1)CN1CCCC1 |
| InChI | InChI=1S/C12H19NO3/c14-11(8-13-5-1-2-6-13)9-15-10-12-4-3-7-16-12/h3-4,7,11,14H,1-2,5-6,8-10H2/t11-/m0/s1 |
| InChIKey | IAICTQOJDXPPLB-NSHDSACASA-N |
| XLogP | 1.25 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |