C17H27NO3 — CID 111437430
1-(8-azaspiro[4.5]decan-8-yl)-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 111437430) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(8-azaspiro[4.5]decan-8-yl)-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(8-azaspiro[4.5]decan-8-yl)-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 111437430 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(8-azaspiro[4.5]decan-8-yl)-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(COCc1ccco1)CN1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C17H27NO3/c19-15(13-20-14-16-4-3-11-21-16)12-18-9-7-17(8-10-18)5-1-2-6-17/h3-4,11,15,19H,1-2,5-10,12-14H2 |
| InChIKey | YQFXVDYOVQGRJQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |