C18H23ClN2O3 — CID 3681676
1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 3681676) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 3681676 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(COCc1ccco1)CN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H23ClN2O3/c19-15-3-5-16(6-4-15)21-9-7-20(8-10-21)12-17(22)13-23-14-18-2-1-11-24-18/h1-6,11,17,22H,7-10,12-14H2 |
| InChIKey | LJEMIDUQJBKKFB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |