C21H27ClN2O7 — CID 15945140
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol;oxalic acid (PubChem CID 15945140) has the molecular formula C21H27ClN2O7 and a molecular weight of 454.91 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol;oxalic acid.
| Compound Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 15945140 |
| Molecular Formula | C21H27ClN2O7 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(furan-2-ylmethoxy)propan-2-ol;oxalic acid |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CC(O)COCc2ccco2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25ClN2O3.C2H2O4/c1-15-4-5-16(20)11-19(15)22-8-6-21(7-9-22)12-17(23)13-24-14-18-3-2-10-25-18;3-1(4)2(5)6/h2-5,10-11,17,23H,6-9,12-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HXJGCGWAXIGHEF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|