C26H29ClN2O2 — CID 30930129
(2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-phenylphenoxy)propan-2-ol (PubChem CID 30930129) has the molecular formula C26H29ClN2O2 and a molecular weight of 436.98 g/mol. Its IUPAC name is (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-phenylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 30930129 |
| Molecular Formula | C26H29ClN2O2 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2R)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-phenylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C[C@@H](O)COc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H29ClN2O2/c1-20-7-10-23(27)17-26(20)29-15-13-28(14-16-29)18-24(30)19-31-25-11-8-22(9-12-25)21-5-3-2-4-6-21/h2-12,17,24,30H,13-16,18-19H2,1H3/t24-/m1/s1 |
| InChIKey | FEFMLCGFAXNKIY-XMMPIXPASA-N |
| XLogP | 4.88 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |