C20H26Cl3N3O4 — CID 2920021
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol;dihydrochloride (PubChem CID 2920021) has the molecular formula C20H26Cl3N3O4 and a molecular weight of 478.80 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol;dihydrochloride.
| Compound Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 2920021 |
| Molecular Formula | C20H26Cl3N3O4 |
| Molecular Weight | 478.80 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol;dihydrochloride |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CC(O)COc2ccc([N+](=O)[O-])cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H24ClN3O4.2ClH/c1-15-2-3-16(21)12-20(15)23-10-8-22(9-11-23)13-18(25)14-28-19-6-4-17(5-7-19)24(26)27;;/h2-7,12,18,25H,8-11,13-14H2,1H3;2*1H |
| InChIKey | DQQUFXCBBXSBNT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|