C19H21F2N3O4 — CID 3865477
1-[4-(2,4-difluorophenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol (PubChem CID 3865477) has the molecular formula C19H21F2N3O4 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 3865477 |
| Molecular Formula | C19H21F2N3O4 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-3-(4-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(OCC(O)CN2CCN(c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C19H21F2N3O4/c20-14-1-6-19(18(21)11-14)23-9-7-22(8-10-23)12-16(25)13-28-17-4-2-15(3-5-17)24(26)27/h1-6,11,16,25H,7-10,12-13H2 |
| InChIKey | TZQSFPNWDUUDLP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|