C22H24F3N3O6 — CID 42926052
methyl 4-[2-hydroxy-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]benzoate (PubChem CID 42926052) has the molecular formula C22H24F3N3O6 and a molecular weight of 483.44 g/mol. Its IUPAC name is methyl 4-[2-hydroxy-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]benzoate.
| Compound Name | methyl 4-[2-hydroxy-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 42926052 |
| Molecular Formula | C22H24F3N3O6 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | methyl 4-[2-hydroxy-3-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(O)CN2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C22H24F3N3O6/c1-33-21(30)15-2-5-18(6-3-15)34-14-17(29)13-26-8-10-27(11-9-26)19-7-4-16(22(23,24)25)12-20(19)28(31)32/h2-7,12,17,29H,8-11,13-14H2,1H3 |
| InChIKey | FYCZNUIYKLGEBL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|