C19H20F3N3O5 — CID 33185126
methyl 3-methyl-5-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carboxylate (PubChem CID 33185126) has the molecular formula C19H20F3N3O5 and a molecular weight of 427.38 g/mol. Its IUPAC name is methyl 3-methyl-5-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-methyl-5-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 33185126 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | methyl 3-methyl-5-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1oc(CN2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc1C |
| InChI | InChI=1S/C19H20F3N3O5/c1-12-9-14(30-17(12)18(26)29-2)11-23-5-7-24(8-6-23)15-4-3-13(19(20,21)22)10-16(15)25(27)28/h3-4,9-10H,5-8,11H2,1-2H3 |
| InChIKey | QSCANIBZAJZYBR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|