C19H17F6N3O2 — CID 91214291
1-[2-nitro-4-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 91214291) has the molecular formula C19H17F6N3O2 and a molecular weight of 433.35 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 91214291 |
| Molecular Formula | C19H17F6N3O2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H17F6N3O2/c20-18(21,22)14-3-1-2-13(10-14)12-26-6-8-27(9-7-26)16-5-4-15(19(23,24)25)11-17(16)28(29)30/h1-5,10-11H,6-9,12H2 |
| InChIKey | DBBSJULLUCRQHZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|