C20H22F3N3O4 — CID 54378771
1-(4,5-dimethoxy-2-nitrophenyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 54378771) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 54378771 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | COc1cc(N2CCN(Cc3cccc(C(F)(F)F)c3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H22F3N3O4/c1-29-18-11-16(17(26(27)28)12-19(18)30-2)25-8-6-24(7-9-25)13-14-4-3-5-15(10-14)20(21,22)23/h3-5,10-12H,6-9,13H2,1-2H3 |
| InChIKey | UYLAGPAJZPZNPO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|