C20H26N4O3 — CID 56979941
5-[4-[(3-methoxyphenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline (PubChem CID 56979941) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-[4-[(3-methoxyphenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline.
| Compound Name | 5-[4-[(3-methoxyphenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 56979941 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 5-[4-[(3-methoxyphenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline |
| SMILES | COc1cccc(CN2CCCN(c3cc(N)c(C)cc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-15-11-20(24(25)26)19(13-18(15)21)23-8-4-7-22(9-10-23)14-16-5-3-6-17(12-16)27-2/h3,5-6,11-13H,4,7-10,14,21H2,1-2H3 |
| InChIKey | DYDLLFQBKXRCLV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|