C20H22N4O6 — CID 166400929
[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone (PubChem CID 166400929) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is [4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone.
| Compound Name | [4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 166400929 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-(4-methyl-3,5-dinitrophenyl)methanone |
| SMILES | COc1cccc(CN2CCN(C(=O)c3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)CC2)c1 |
| InChI | InChI=1S/C20H22N4O6/c1-14-18(23(26)27)11-16(12-19(14)24(28)29)20(25)22-8-6-21(7-9-22)13-15-4-3-5-17(10-15)30-2/h3-5,10-12H,6-9,13H2,1-2H3 |
| InChIKey | QUWAZMKZTHQXHV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|