C26H27N3O5 — CID 19323206
[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone (PubChem CID 19323206) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is [4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone.
| Compound Name | [4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 19323206 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [4-[(3-methoxyphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone |
| SMILES | COc1cccc(CN2CCN(C(=O)c3cccc(COc4ccc([N+](=O)[O-])cc4)c3)CC2)c1 |
| InChI | InChI=1S/C26H27N3O5/c1-33-25-7-3-4-20(17-25)18-27-12-14-28(15-13-27)26(30)22-6-2-5-21(16-22)19-34-24-10-8-23(9-11-24)29(31)32/h2-11,16-17H,12-15,18-19H2,1H3 |
| InChIKey | VBSDODNMHCBQHQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|