C26H27N3O4 — CID 19325302
[4-[(3-methylphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone (PubChem CID 19325302) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [4-[(3-methylphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone.
| Compound Name | [4-[(3-methylphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 19325302 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [4-[(3-methylphenyl)methyl]piperazin-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3cccc(COc4ccc([N+](=O)[O-])cc4)c3)CC2)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-20-4-2-5-21(16-20)18-27-12-14-28(15-13-27)26(30)23-7-3-6-22(17-23)19-33-25-10-8-24(9-11-25)29(31)32/h2-11,16-17H,12-15,18-19H2,1H3 |
| InChIKey | PPVXKJLSUZRUFR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|