C18H23Cl2FN4O2 — CID 70086691
5-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline;dihydrochloride (PubChem CID 70086691) has the molecular formula C18H23Cl2FN4O2 and a molecular weight of 417.31 g/mol. Its IUPAC name is 5-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline;dihydrochloride.
| Compound Name | 5-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline;dihydrochloride |
|---|---|
| PubChem CID | 70086691 |
| Molecular Formula | C18H23Cl2FN4O2 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline;dihydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])c(N2CCN(Cc3cccc(F)c3)CC2)cc1N.Cl.Cl |
| InChI | InChI=1S/C18H21FN4O2.2ClH/c1-13-9-18(23(24)25)17(11-16(13)20)22-7-5-21(6-8-22)12-14-3-2-4-15(19)10-14;;/h2-4,9-11H,5-8,12,20H2,1H3;2*1H |
| InChIKey | GAQJURVMDHUYOD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|