C18H21ClN4O2 — CID 57029310
5-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline (PubChem CID 57029310) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 5-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline.
| Compound Name | 5-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 57029310 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-methyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])c(N2CCN(Cc3ccccc3Cl)CC2)cc1N |
| InChI | InChI=1S/C18H21ClN4O2/c1-13-10-18(23(24)25)17(11-16(13)20)22-8-6-21(7-9-22)12-14-4-2-3-5-15(14)19/h2-5,10-11H,6-9,12,20H2,1H3 |
| InChIKey | KJWLFNGJCUWICA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|