C19H22Cl2N4O2 — CID 57247974
5-[4-[(2,6-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline (PubChem CID 57247974) has the molecular formula C19H22Cl2N4O2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 5-[4-[(2,6-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline.
| Compound Name | 5-[4-[(2,6-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 57247974 |
| Molecular Formula | C19H22Cl2N4O2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-[4-[(2,6-dichlorophenyl)methyl]-1,4-diazepan-1-yl]-2-methyl-4-nitroaniline |
| SMILES | Cc1cc([N+](=O)[O-])c(N2CCCN(Cc3c(Cl)cccc3Cl)CC2)cc1N |
| InChI | InChI=1S/C19H22Cl2N4O2/c1-13-10-19(25(26)27)18(11-17(13)22)24-7-3-6-23(8-9-24)12-14-15(20)4-2-5-16(14)21/h2,4-5,10-11H,3,6-9,12,22H2,1H3 |
| InChIKey | PGJIDGKUOQJOJT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|