C17H16Cl2N4O4 — CID 3094079
1,4-bis(4-chloro-2-nitrophenyl)-1,4-diazepane (PubChem CID 3094079) has the molecular formula C17H16Cl2N4O4 and a molecular weight of 411.25 g/mol. Its IUPAC name is 1,4-bis(4-chloro-2-nitrophenyl)-1,4-diazepane.
| Compound Name | 1,4-bis(4-chloro-2-nitrophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 3094079 |
| Molecular Formula | C17H16Cl2N4O4 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 1,4-bis(4-chloro-2-nitrophenyl)-1,4-diazepane |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1N1CCCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H16Cl2N4O4/c18-12-2-4-14(16(10-12)22(24)25)20-6-1-7-21(9-8-20)15-5-3-13(19)11-17(15)23(26)27/h2-5,10-11H,1,6-9H2 |
| InChIKey | AHBHFIPREALAPI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|