C11H15ClN3O2+ — CID 5055951
1-(4-chloro-2-nitrophenyl)-1,4-diazepan-4-ium (PubChem CID 5055951) has the molecular formula C11H15ClN3O2+ and a molecular weight of 256.71 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)-1,4-diazepan-4-ium.
| Compound Name | 1-(4-chloro-2-nitrophenyl)-1,4-diazepan-4-ium |
|---|---|
| PubChem CID | 5055951 |
| Molecular Formula | C11H15ClN3O2+ |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)-1,4-diazepan-4-ium |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1N1CCC[NH2+]CC1 |
| InChI | InChI=1S/C11H14ClN3O2/c12-9-2-3-10(11(8-9)15(16)17)14-6-1-4-13-5-7-14/h2-3,8,13H,1,4-7H2/p+1 |
| InChIKey | KLZCNMVBZDWQIE-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 62.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|