C12H16ClN3O2 — CID 162442759
1-(4-chloro-2-nitrophenyl)-4-methyl-1,4-diazepane (PubChem CID 162442759) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)-4-methyl-1,4-diazepane.
| Compound Name | 1-(4-chloro-2-nitrophenyl)-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 162442759 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-14-5-2-6-15(8-7-14)11-4-3-10(13)9-12(11)16(17)18/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | OKYYUALTHSOOPH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|