C14H23N3O2 — CID 91421096
ethane;1-methyl-4-(2-nitrophenyl)-1,4-diazepane (PubChem CID 91421096) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is ethane;1-methyl-4-(2-nitrophenyl)-1,4-diazepane.
| Compound Name | ethane;1-methyl-4-(2-nitrophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 91421096 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | ethane;1-methyl-4-(2-nitrophenyl)-1,4-diazepane |
| SMILES | CC.CN1CCCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H17N3O2.C2H6/c1-13-7-4-8-14(10-9-13)11-5-2-3-6-12(11)15(16)17;1-2/h2-3,5-6H,4,7-10H2,1H3;1-2H3 |
| InChIKey | RFWMEOGAAKBSMI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|