C12H16ClN3O4S — CID 134038762
1-(4-chloro-2-nitrophenyl)-4-methylsulfonyl-1,4-diazepane (PubChem CID 134038762) has the molecular formula C12H16ClN3O4S and a molecular weight of 333.80 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-(4-chloro-2-nitrophenyl)-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 134038762 |
| Molecular Formula | C12H16ClN3O4S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)-4-methylsulfonyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H16ClN3O4S/c1-21(19,20)15-6-2-5-14(7-8-15)11-4-3-10(13)9-12(11)16(17)18/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | PMYWYNILKFVZIK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|