C15H24N4O6S2 — CID 24525906
N,N-diethyl-4-(4-methylsulfonylpiperazin-1-yl)-3-nitrobenzenesulfonamide (PubChem CID 24525906) has the molecular formula C15H24N4O6S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is N,N-diethyl-4-(4-methylsulfonylpiperazin-1-yl)-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-(4-methylsulfonylpiperazin-1-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24525906 |
| Molecular Formula | C15H24N4O6S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N,N-diethyl-4-(4-methylsulfonylpiperazin-1-yl)-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(S(C)(=O)=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H24N4O6S2/c1-4-17(5-2)27(24,25)13-6-7-14(15(12-13)19(20)21)16-8-10-18(11-9-16)26(3,22)23/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | FAPOBADNEBECLH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|