C16H27N4O4S+ — CID 7761235
N,N-diethyl-4-(4-ethylpiperazin-4-ium-1-yl)-3-nitrobenzenesulfonamide (PubChem CID 7761235) has the molecular formula C16H27N4O4S+ and a molecular weight of 371.48 g/mol. Its IUPAC name is N,N-diethyl-4-(4-ethylpiperazin-4-ium-1-yl)-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-(4-ethylpiperazin-4-ium-1-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7761235 |
| Molecular Formula | C16H27N4O4S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N,N-diethyl-4-(4-ethylpiperazin-4-ium-1-yl)-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CC[NH+](CC)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H26N4O4S/c1-4-17-9-11-18(12-10-17)15-8-7-14(13-16(15)20(21)22)25(23,24)19(5-2)6-3/h7-8,13H,4-6,9-12H2,1-3H3/p+1 |
| InChIKey | OAPYRQDHVKNBSF-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|