C22H28N4O5S2 — CID 24545988
N,N-diethyl-4-[4-(4-methylsulfanylbenzoyl)piperazin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 24545988) has the molecular formula C22H28N4O5S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is N,N-diethyl-4-[4-(4-methylsulfanylbenzoyl)piperazin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[4-(4-methylsulfanylbenzoyl)piperazin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24545988 |
| Molecular Formula | C22H28N4O5S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N,N-diethyl-4-[4-(4-methylsulfanylbenzoyl)piperazin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(C(=O)c3ccc(SC)cc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28N4O5S2/c1-4-25(5-2)33(30,31)19-10-11-20(21(16-19)26(28)29)23-12-14-24(15-13-23)22(27)17-6-8-18(32-3)9-7-17/h6-11,16H,4-5,12-15H2,1-3H3 |
| InChIKey | UMMHVCFRVIIIKU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|