C22H31N5O6S — CID 24585868
4-[4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 24585868) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is 4-[4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24585868 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-[4-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propanoyl]piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(C(=O)CCc3c(C)noc3C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H31N5O6S/c1-5-26(6-2)34(31,32)18-7-9-20(21(15-18)27(29)30)24-11-13-25(14-12-24)22(28)10-8-19-16(3)23-33-17(19)4/h7,9,15H,5-6,8,10-14H2,1-4H3 |
| InChIKey | USNMNPLNORGUHW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 130.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|