C16H20N6O3 — CID 56737384
1-[4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]butan-1-one (PubChem CID 56737384) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-[4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 56737384 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-[4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(c2ccc(-n3cnnc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H20N6O3/c1-2-3-16(23)20-8-6-19(7-9-20)14-5-4-13(10-15(14)22(24)25)21-11-17-18-12-21/h4-5,10-12H,2-3,6-9H2,1H3 |
| InChIKey | AAHQCVJVOLNPHL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|